About 1-nitrobutane-2,3-diol
1-nitrobutane-2,3-diol (PubChem CID 131257567) has the molecular formula C4H9NO4
and a molecular weight of 135.12 g/mol. Its IUPAC name is 1-nitrobutane-2,3-diol.
Molecular Properties
| Compound Name | 1-nitrobutane-2,3-diol |
| PubChem CID | 131257567 |
| Molecular Formula | C4H9NO4 |
| Molecular Weight | 135.12 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | 1-nitrobutane-2,3-diol |
| SMILES | CC(O)C(O)C[N+](=O)[O-] |
| InChI | InChI=1S/C4H9NO4/c1-3(6)4(7)2-5(8)9/h3-4,6-7H,2H2,1H3 |
| InChIKey | BSHYRZRYCWBDMX-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.12 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitrobutane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitrobutane-2,3-diol?
The IUPAC name of 1-nitrobutane-2,3-diol (CID 131257567) is 1-nitrobutane-2,3-diol.
What is the SMILES notation for 1-nitrobutane-2,3-diol?
The canonical SMILES for 1-nitrobutane-2,3-diol is CC(O)C(O)C[N+](=O)[O-].
What is the InChIKey of 1-nitrobutane-2,3-diol?
The InChIKey is BSHYRZRYCWBDMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO4/c1-3(6)4(7)2-5(8)9/h3-4,6-7H,2H2,1H3.
What are the key properties of 1-nitrobutane-2,3-diol?
1-nitrobutane-2,3-diol has a molecular weight of 135.12 g/mol, XLogP of -1.00, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitrobutane-2,3-diol is sourced from PubChem (CID 131257567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).