About 2-methyl-1,3-benzoxaphosphole
2-methyl-1,3-benzoxaphosphole (PubChem CID 13125851) has the molecular formula C8H7OP
and a molecular weight of 150.12 g/mol. Its IUPAC name is 2-methyl-1,3-benzoxaphosphole.
Molecular Properties
| Compound Name | 2-methyl-1,3-benzoxaphosphole |
| PubChem CID | 13125851 |
| Molecular Formula | C8H7OP |
| Molecular Weight | 150.12 g/mol |
| Exact Mass | 150.02 |
| IUPAC Name | 2-methyl-1,3-benzoxaphosphole |
| SMILES | Cc1oc2ccccc2p1 |
| InChI | InChI=1S/C8H7OP/c1-6-9-7-4-2-3-5-8(7)10-6/h2-5H,1H3 |
| InChIKey | JATKYNFBKAVWAS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.12 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-1,3-benzoxaphosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,3-benzoxaphosphole?
The IUPAC name of 2-methyl-1,3-benzoxaphosphole (CID 13125851) is 2-methyl-1,3-benzoxaphosphole.
What is the SMILES notation for 2-methyl-1,3-benzoxaphosphole?
The canonical SMILES for 2-methyl-1,3-benzoxaphosphole is Cc1oc2ccccc2p1.
What is the InChIKey of 2-methyl-1,3-benzoxaphosphole?
The InChIKey is JATKYNFBKAVWAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7OP/c1-6-9-7-4-2-3-5-8(7)10-6/h2-5H,1H3.
What are the key properties of 2-methyl-1,3-benzoxaphosphole?
2-methyl-1,3-benzoxaphosphole has a molecular weight of 150.12 g/mol, XLogP of 3.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3-benzoxaphosphole is sourced from PubChem (CID 13125851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).