About N-pyrrol-1-yl-4,5-dihydro-1H-imidazol-2-amine
N-pyrrol-1-yl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 13126154) has the molecular formula C7H10N4
and a molecular weight of 150.19 g/mol. Its IUPAC name is N-pyrrol-1-yl-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | N-pyrrol-1-yl-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 13126154 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.19 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | N-pyrrol-1-yl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | c1ccn(NC2=NCCN2)c1 |
| InChI | InChI=1S/C7H10N4/c1-2-6-11(5-1)10-7-8-3-4-9-7/h1-2,5-6H,3-4H2,(H2,8,9,10) |
| InChIKey | ACRFIIUOVAGNFP-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 41.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.19 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-pyrrol-1-yl-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyrrol-1-yl-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of N-pyrrol-1-yl-4,5-dihydro-1H-imidazol-2-amine (CID 13126154) is N-pyrrol-1-yl-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for N-pyrrol-1-yl-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for N-pyrrol-1-yl-4,5-dihydro-1H-imidazol-2-amine is c1ccn(NC2=NCCN2)c1.
What is the InChIKey of N-pyrrol-1-yl-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is ACRFIIUOVAGNFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4/c1-2-6-11(5-1)10-7-8-3-4-9-7/h1-2,5-6H,3-4H2,(H2,8,9,10).
What are the key properties of N-pyrrol-1-yl-4,5-dihydro-1H-imidazol-2-amine?
N-pyrrol-1-yl-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 150.19 g/mol, XLogP of -0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyrrol-1-yl-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 13126154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).