C24H25N3O6S — CID 1312620
2-(2,3-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-(2-methoxy-5-nitrophenyl)acetamide (PubChem CID 1312620) has the molecular formula C24H25N3O6S and a molecular weight of 483.55 g/mol. Its IUPAC name is 2-(2,3-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-(2-methoxy-5-nitrophenyl)acetamide.
| Compound Name | 2-(2,3-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-(2-methoxy-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 1312620 |
| Molecular Formula | C24H25N3O6S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 2-(2,3-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-(2-methoxy-5-nitrophenyl)acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CN(c1cccc(C)c1C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H25N3O6S/c1-16-8-11-20(12-9-16)34(31,32)26(22-7-5-6-17(2)18(22)3)15-24(28)25-21-14-19(27(29)30)10-13-23(21)33-4/h5-14H,15H2,1-4H3,(H,25,28) |
| InChIKey | ODNAJXSATLPFRC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|