About 4-bromo-5-cyclohexyl-2-(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide
4-bromo-5-cyclohexyl-2-(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide (PubChem CID 13126420) has the molecular formula C22H23BrN2OS
and a molecular weight of 443.41 g/mol. Its IUPAC name is 4-bromo-5-cyclohexyl-2-(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide.
Molecular Properties
| Compound Name | 4-bromo-5-cyclohexyl-2-(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide |
| PubChem CID | 13126420 |
| Molecular Formula | C22H23BrN2OS |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 4-bromo-5-cyclohexyl-2-(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide |
| SMILES | Cc1ccc(N2C(c3ccccc3)=C(Br)C(C3CCCCC3)=NS2=O)cc1 |
| InChI | InChI=1S/C22H23BrN2OS/c1-16-12-14-19(15-13-16)25-22(18-10-6-3-7-11-18)20(23)21(24-27(25)26)17-8-4-2-5-9-17/h3,6-7,10-15,17H,2,4-5,8-9H2,1H3 |
| InChIKey | INSSHFGKTVZFBN-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-5-cyclohexyl-2-(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-cyclohexyl-2-(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide?
The IUPAC name of 4-bromo-5-cyclohexyl-2-(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide (CID 13126420) is 4-bromo-5-cyclohexyl-2-(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide.
What is the SMILES notation for 4-bromo-5-cyclohexyl-2-(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide?
The canonical SMILES for 4-bromo-5-cyclohexyl-2-(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide is Cc1ccc(N2C(c3ccccc3)=C(Br)C(C3CCCCC3)=NS2=O)cc1.
What is the InChIKey of 4-bromo-5-cyclohexyl-2-(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide?
The InChIKey is INSSHFGKTVZFBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23BrN2OS/c1-16-12-14-19(15-13-16)25-22(18-10-6-3-7-11-18)20(23)21(24-27(25)26)17-8-4-2-5-9-17/h3,6-7,10-15,17H,2,4-5,8-9H2,1H3.
What are the key properties of 4-bromo-5-cyclohexyl-2-(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide?
4-bromo-5-cyclohexyl-2-(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide has a molecular weight of 443.41 g/mol, XLogP of 6.18, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-cyclohexyl-2-(4-methylphenyl)-3-phenyl-1,2,6-thiadiazine 1-oxide is sourced from PubChem (CID 13126420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).