C6H18OS2Si3 — CID 13126476
2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-oxadithiatrisilinane (PubChem CID 13126476) has the molecular formula C6H18OS2Si3 and a molecular weight of 254.60 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-oxadithiatrisilinane.
| Compound Name | 2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-oxadithiatrisilinane |
|---|---|
| PubChem CID | 13126476 |
| Molecular Formula | C6H18OS2Si3 |
| Molecular Weight | 254.60 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 2,2,4,4,6,6-hexamethyl-1,3,5,2,4,6-oxadithiatrisilinane |
| SMILES | C[Si]1(C)O[Si](C)(C)S[Si](C)(C)S1 |
| InChI | InChI=1S/C6H18OS2Si3/c1-10(2)7-11(3,4)9-12(5,6)8-10/h1-6H3 |
| InChIKey | CBZUCTIRXYVNDH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.60 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|