About methyl 5,6,7,8-tetrahydro-4H-thieno[3,2-c]azepine-2-carboxylate
methyl 5,6,7,8-tetrahydro-4H-thieno[3,2-c]azepine-2-carboxylate (PubChem CID 131270641) has the molecular formula C10H13NO2S
and a molecular weight of 211.29 g/mol. Its IUPAC name is methyl 5,6,7,8-tetrahydro-4H-thieno[3,2-c]azepine-2-carboxylate.
Analyze methyl 5,6,7,8-tetrahydro-4H-thieno[3,2-c]azepine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5,6,7,8-tetrahydro-4H-thieno[3,2-c]azepine-2-carboxylate?
The IUPAC name of methyl 5,6,7,8-tetrahydro-4H-thieno[3,2-c]azepine-2-carboxylate (CID 131270641) is methyl 5,6,7,8-tetrahydro-4H-thieno[3,2-c]azepine-2-carboxylate.
What is the SMILES notation for methyl 5,6,7,8-tetrahydro-4H-thieno[3,2-c]azepine-2-carboxylate?
The canonical SMILES for methyl 5,6,7,8-tetrahydro-4H-thieno[3,2-c]azepine-2-carboxylate is COC(=O)c1cc2c(s1)CCCNC2.
What is the InChIKey of methyl 5,6,7,8-tetrahydro-4H-thieno[3,2-c]azepine-2-carboxylate?
The InChIKey is RRBDUBLXCULKRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S/c1-13-10(12)9-5-7-6-11-4-2-3-8(7)14-9/h5,11H,2-4,6H2,1H3.
What are the key properties of methyl 5,6,7,8-tetrahydro-4H-thieno[3,2-c]azepine-2-carboxylate?
methyl 5,6,7,8-tetrahydro-4H-thieno[3,2-c]azepine-2-carboxylate has a molecular weight of 211.29 g/mol, XLogP of 1.57, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5,6,7,8-tetrahydro-4H-thieno[3,2-c]azepine-2-carboxylate is sourced from PubChem (CID 131270641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).