C20H13F7OS — CID 13127246
2-[4,5-bis(4-fluorophenyl)thiophen-2-yl]-3,3,4,4,4-pentafluorobutan-2-ol (PubChem CID 13127246) has the molecular formula C20H13F7OS and a molecular weight of 434.38 g/mol. Its IUPAC name is 2-[4,5-bis(4-fluorophenyl)thiophen-2-yl]-3,3,4,4,4-pentafluorobutan-2-ol.
| Compound Name | 2-[4,5-bis(4-fluorophenyl)thiophen-2-yl]-3,3,4,4,4-pentafluorobutan-2-ol |
|---|---|
| PubChem CID | 13127246 |
| Molecular Formula | C20H13F7OS |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 2-[4,5-bis(4-fluorophenyl)thiophen-2-yl]-3,3,4,4,4-pentafluorobutan-2-ol |
| SMILES | CC(O)(c1cc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)s1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H13F7OS/c1-18(28,19(23,24)20(25,26)27)16-10-15(11-2-6-13(21)7-3-11)17(29-16)12-4-8-14(22)9-5-12/h2-10,28H,1H3 |
| InChIKey | GCVFDFLNTITJDH-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|