About 3-[(2-chloroacetyl)amino]-1H-1,2,4-triazole-5-carboxamide
3-[(2-chloroacetyl)amino]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 131275025) has the molecular formula C5H6ClN5O2
and a molecular weight of 203.59 g/mol. Its IUPAC name is 3-[(2-chloroacetyl)amino]-1H-1,2,4-triazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-[(2-chloroacetyl)amino]-1H-1,2,4-triazole-5-carboxamide |
| PubChem CID | 131275025 |
| Molecular Formula | C5H6ClN5O2 |
| Molecular Weight | 203.59 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 3-[(2-chloroacetyl)amino]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | NC(=O)c1nc(NC(=O)CCl)n[nH]1 |
| InChI | InChI=1S/C5H6ClN5O2/c6-1-2(12)8-5-9-4(3(7)13)10-11-5/h1H2,(H2,7,13)(H2,8,9,10,11,12) |
| InChIKey | VJOGCNIZZZYEPY-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.59 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-chloroacetyl)amino]-1H-1,2,4-triazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-chloroacetyl)amino]-1H-1,2,4-triazole-5-carboxamide?
The IUPAC name of 3-[(2-chloroacetyl)amino]-1H-1,2,4-triazole-5-carboxamide (CID 131275025) is 3-[(2-chloroacetyl)amino]-1H-1,2,4-triazole-5-carboxamide.
What is the SMILES notation for 3-[(2-chloroacetyl)amino]-1H-1,2,4-triazole-5-carboxamide?
The canonical SMILES for 3-[(2-chloroacetyl)amino]-1H-1,2,4-triazole-5-carboxamide is NC(=O)c1nc(NC(=O)CCl)n[nH]1.
What is the InChIKey of 3-[(2-chloroacetyl)amino]-1H-1,2,4-triazole-5-carboxamide?
The InChIKey is VJOGCNIZZZYEPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6ClN5O2/c6-1-2(12)8-5-9-4(3(7)13)10-11-5/h1H2,(H2,7,13)(H2,8,9,10,11,12).
What are the key properties of 3-[(2-chloroacetyl)amino]-1H-1,2,4-triazole-5-carboxamide?
3-[(2-chloroacetyl)amino]-1H-1,2,4-triazole-5-carboxamide has a molecular weight of 203.59 g/mol, XLogP of -0.92, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-chloroacetyl)amino]-1H-1,2,4-triazole-5-carboxamide is sourced from PubChem (CID 131275025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).