About 11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecane
11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecane (PubChem CID 131277394) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecane.
Molecular Properties
| Compound Name | 11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecane |
| PubChem CID | 131277394 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecane |
| SMILES | CN1CCOCC2(CCCNC2)C1 |
| InChI | InChI=1S/C10H20N2O/c1-12-5-6-13-9-10(8-12)3-2-4-11-7-10/h11H,2-9H2,1H3 |
| InChIKey | BVCPRJPZIZXPLM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecane?
The IUPAC name of 11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecane (CID 131277394) is 11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecane.
What is the SMILES notation for 11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecane?
The canonical SMILES for 11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecane is CN1CCOCC2(CCCNC2)C1.
What is the InChIKey of 11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecane?
The InChIKey is BVCPRJPZIZXPLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-12-5-6-13-9-10(8-12)3-2-4-11-7-10/h11H,2-9H2,1H3.
What are the key properties of 11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecane?
11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecane has a molecular weight of 184.28 g/mol, XLogP of 0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methyl-8-oxa-2,11-diazaspiro[5.6]dodecane is sourced from PubChem (CID 131277394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).