C20H32O6 — CID 13127875
11,12,23,24-tetraoxadispiro[9.2.913.210]tetracosane-5,18-dione (PubChem CID 13127875) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is 11,12,23,24-tetraoxadispiro[9.2.913.210]tetracosane-5,18-dione.
| Compound Name | 11,12,23,24-tetraoxadispiro[9.2.913.210]tetracosane-5,18-dione |
|---|---|
| PubChem CID | 13127875 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 11,12,23,24-tetraoxadispiro[9.2.913.210]tetracosane-5,18-dione |
| SMILES | O=C1CCCCC2(CCCC1)OOC1(CCCCC(=O)CCCC1)OO2 |
| InChI | InChI=1S/C20H32O6/c21-17-9-1-5-13-19(14-6-2-10-17)23-25-20(26-24-19)15-7-3-11-18(22)12-4-8-16-20/h1-16H2 |
| InChIKey | HZDZXRKGXHJMQI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|