C8H3F6NO — CID 131282107
3,5-bis(trifluoromethyl)pyridine-2-carbaldehyde (PubChem CID 131282107) has the molecular formula C8H3F6NO and a molecular weight of 243.11 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)pyridine-2-carbaldehyde.
| Compound Name | 3,5-bis(trifluoromethyl)pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 131282107 |
| Molecular Formula | C8H3F6NO |
| Molecular Weight | 243.11 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 3,5-bis(trifluoromethyl)pyridine-2-carbaldehyde |
| SMILES | O=Cc1ncc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C8H3F6NO/c9-7(10,11)4-1-5(8(12,13)14)6(3-16)15-2-4/h1-3H |
| InChIKey | HZYPMYGTUGXCNJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.11 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|