C7H4F3N3O2 — CID 131282215
6-amino-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-carbonitrile (PubChem CID 131282215) has the molecular formula C7H4F3N3O2 and a molecular weight of 219.12 g/mol. Its IUPAC name is 6-amino-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-carbonitrile.
| Compound Name | 6-amino-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 131282215 |
| Molecular Formula | C7H4F3N3O2 |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 6-amino-2-oxo-3-(trifluoromethoxy)-1H-pyridine-4-carbonitrile |
| SMILES | N#Cc1cc(N)[nH]c(=O)c1OC(F)(F)F |
| InChI | InChI=1S/C7H4F3N3O2/c8-7(9,10)15-5-3(2-11)1-4(12)13-6(5)14/h1H,(H3,12,13,14) |
| InChIKey | CWKULFZCBAOZSG-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |