About 1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one
1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 13128360) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
Analyze 1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one?
The IUPAC name of 1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (CID 13128360) is 1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
What is the SMILES notation for 1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one?
The canonical SMILES for 1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one is O=C1OCC2CCC=CN12.
What is the InChIKey of 1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one?
The InChIKey is XUHIOFZVXGYEAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c9-7-8-4-2-1-3-6(8)5-10-7/h2,4,6H,1,3,5H2.
What are the key properties of 1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one?
1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one has a molecular weight of 139.15 g/mol, XLogP of 1.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one is sourced from PubChem (CID 13128360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).