C12H25NO5 — CID 13128587
11-ethyl-1,4,7-trioxa-11-azacyclotetradecane-9,13-diol (PubChem CID 13128587) has the molecular formula C12H25NO5 and a molecular weight of 263.33 g/mol. Its IUPAC name is 11-ethyl-1,4,7-trioxa-11-azacyclotetradecane-9,13-diol.
| Compound Name | 11-ethyl-1,4,7-trioxa-11-azacyclotetradecane-9,13-diol |
|---|---|
| PubChem CID | 13128587 |
| Molecular Formula | C12H25NO5 |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 11-ethyl-1,4,7-trioxa-11-azacyclotetradecane-9,13-diol |
| SMILES | CCN1CC(O)COCCOCCOCC(O)C1 |
| InChI | InChI=1S/C12H25NO5/c1-2-13-7-11(14)9-17-5-3-16-4-6-18-10-12(15)8-13/h11-12,14-15H,2-10H2,1H3 |
| InChIKey | QQDCGLXBNBETBB-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |