C16H33NO7 — CID 13128589
17-ethyl-1,4,7,10,13-pentaoxa-17-azacycloicosane-15,19-diol (PubChem CID 13128589) has the molecular formula C16H33NO7 and a molecular weight of 351.44 g/mol. Its IUPAC name is 17-ethyl-1,4,7,10,13-pentaoxa-17-azacycloicosane-15,19-diol.
| Compound Name | 17-ethyl-1,4,7,10,13-pentaoxa-17-azacycloicosane-15,19-diol |
|---|---|
| PubChem CID | 13128589 |
| Molecular Formula | C16H33NO7 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 17-ethyl-1,4,7,10,13-pentaoxa-17-azacycloicosane-15,19-diol |
| SMILES | CCN1CC(O)COCCOCCOCCOCCOCC(O)C1 |
| InChI | InChI=1S/C16H33NO7/c1-2-17-11-15(18)13-23-9-7-21-5-3-20-4-6-22-8-10-24-14-16(19)12-17/h15-16,18-19H,2-14H2,1H3 |
| InChIKey | HSGWLSIMEGWNSI-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |