C30H20F7O2P — CID 13128781
4,4,5,5,6,6,6-heptafluoro-1-phenyl-2-(triphenyl-lambda5-phosphanylidene)hexane-1,3-dione (PubChem CID 13128781) has the molecular formula C30H20F7O2P and a molecular weight of 576.45 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluoro-1-phenyl-2-(triphenyl-lambda5-phosphanylidene)hexane-1,3-dione.
| Compound Name | 4,4,5,5,6,6,6-heptafluoro-1-phenyl-2-(triphenyl-lambda5-phosphanylidene)hexane-1,3-dione |
|---|---|
| PubChem CID | 13128781 |
| Molecular Formula | C30H20F7O2P |
| Molecular Weight | 576.45 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluoro-1-phenyl-2-(triphenyl-lambda5-phosphanylidene)hexane-1,3-dione |
| SMILES | O=C(C(C(=O)C(F)(F)C(F)(F)C(F)(F)F)=P(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H20F7O2P/c31-28(32,29(33,34)30(35,36)37)27(39)26(25(38)21-13-5-1-6-14-21)40(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H |
| InChIKey | NCWJAMOSYZWYQD-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.45 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|