C7HCl7 — CID 13129116
1,2,3,4,5-pentachloro-6-(dichloromethyl)benzene (PubChem CID 13129116) has the molecular formula C7HCl7 and a molecular weight of 333.26 g/mol. Its IUPAC name is 1,2,3,4,5-pentachloro-6-(dichloromethyl)benzene.
| Compound Name | 1,2,3,4,5-pentachloro-6-(dichloromethyl)benzene |
|---|---|
| PubChem CID | 13129116 |
| Molecular Formula | C7HCl7 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 329.79 |
| IUPAC Name | 1,2,3,4,5-pentachloro-6-(dichloromethyl)benzene |
| SMILES | Clc1c(Cl)c(Cl)c(C(Cl)Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C7HCl7/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h7H |
| InChIKey | AWLHOCSHUCRWFB-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|