C11H18O3S3 — CID 13129159
1-[2,2-bis(methylsulfanyl)ethenylsulfonylmethyl]cyclohex-2-en-1-ol (PubChem CID 13129159) has the molecular formula C11H18O3S3 and a molecular weight of 294.46 g/mol. Its IUPAC name is 1-[2,2-bis(methylsulfanyl)ethenylsulfonylmethyl]cyclohex-2-en-1-ol.
| Compound Name | 1-[2,2-bis(methylsulfanyl)ethenylsulfonylmethyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 13129159 |
| Molecular Formula | C11H18O3S3 |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 1-[2,2-bis(methylsulfanyl)ethenylsulfonylmethyl]cyclohex-2-en-1-ol |
| SMILES | CSC(=CS(=O)(=O)CC1(O)C=CCCC1)SC |
| InChI | InChI=1S/C11H18O3S3/c1-15-10(16-2)8-17(13,14)9-11(12)6-4-3-5-7-11/h4,6,8,12H,3,5,7,9H2,1-2H3 |
| InChIKey | FVYJASOBHIEAHA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|