C9H6Br2F2O2 — CID 131291755
1-[3,5-dibromo-2-(difluoromethoxy)phenyl]ethanone (PubChem CID 131291755) has the molecular formula C9H6Br2F2O2 and a molecular weight of 343.95 g/mol. Its IUPAC name is 1-[3,5-dibromo-2-(difluoromethoxy)phenyl]ethanone.
| Compound Name | 1-[3,5-dibromo-2-(difluoromethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 131291755 |
| Molecular Formula | C9H6Br2F2O2 |
| Molecular Weight | 343.95 g/mol |
| Exact Mass | 341.87 |
| IUPAC Name | 1-[3,5-dibromo-2-(difluoromethoxy)phenyl]ethanone |
| SMILES | CC(=O)c1cc(Br)cc(Br)c1OC(F)F |
| InChI | InChI=1S/C9H6Br2F2O2/c1-4(14)6-2-5(10)3-7(11)8(6)15-9(12)13/h2-3,9H,1H3 |
| InChIKey | QTQJUBOKCYCHMB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.95 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |