C7H6IN3 — CID 131292855
3,5-diamino-4-iodobenzonitrile (PubChem CID 131292855) has the molecular formula C7H6IN3 and a molecular weight of 259.05 g/mol. Its IUPAC name is 3,5-diamino-4-iodobenzonitrile.
| Compound Name | 3,5-diamino-4-iodobenzonitrile |
|---|---|
| PubChem CID | 131292855 |
| Molecular Formula | C7H6IN3 |
| Molecular Weight | 259.05 g/mol |
| Exact Mass | 258.96 |
| IUPAC Name | 3,5-diamino-4-iodobenzonitrile |
| SMILES | N#Cc1cc(N)c(I)c(N)c1 |
| InChI | InChI=1S/C7H6IN3/c8-7-5(10)1-4(3-9)2-6(7)11/h1-2H,10-11H2 |
| InChIKey | RBCBQEMPQRIDHV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.05 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|