About N'-ethyl-N,N-dimethylbenzenecarboximidamide
N'-ethyl-N,N-dimethylbenzenecarboximidamide (PubChem CID 13129372) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is N'-ethyl-N,N-dimethylbenzenecarboximidamide.
Molecular Properties
| Compound Name | N'-ethyl-N,N-dimethylbenzenecarboximidamide |
| PubChem CID | 13129372 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N'-ethyl-N,N-dimethylbenzenecarboximidamide |
| SMILES | CC/N=C(/c1ccccc1)N(C)C |
| InChI | InChI=1S/C11H16N2/c1-4-12-11(13(2)3)10-8-6-5-7-9-10/h5-9H,4H2,1-3H3/b12-11- |
| InChIKey | GCSLLLKWCFDGSX-QXMHVHEDSA-N |
| XLogP | 2.01 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N,N-dimethylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N,N-dimethylbenzenecarboximidamide?
The IUPAC name of N'-ethyl-N,N-dimethylbenzenecarboximidamide (CID 13129372) is N'-ethyl-N,N-dimethylbenzenecarboximidamide.
What is the SMILES notation for N'-ethyl-N,N-dimethylbenzenecarboximidamide?
The canonical SMILES for N'-ethyl-N,N-dimethylbenzenecarboximidamide is CC/N=C(/c1ccccc1)N(C)C.
What is the InChIKey of N'-ethyl-N,N-dimethylbenzenecarboximidamide?
The InChIKey is GCSLLLKWCFDGSX-QXMHVHEDSA-N. The full InChI is InChI=1S/C11H16N2/c1-4-12-11(13(2)3)10-8-6-5-7-9-10/h5-9H,4H2,1-3H3/b12-11-.
What are the key properties of N'-ethyl-N,N-dimethylbenzenecarboximidamide?
N'-ethyl-N,N-dimethylbenzenecarboximidamide has a molecular weight of 176.26 g/mol, XLogP of 2.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N,N-dimethylbenzenecarboximidamide is sourced from PubChem (CID 13129372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).