About 2-methoxy-1,2,4,5-tetraphenylpyrrol-3-one
2-methoxy-1,2,4,5-tetraphenylpyrrol-3-one (PubChem CID 13129379) has the molecular formula C29H23NO2
and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-methoxy-1,2,4,5-tetraphenylpyrrol-3-one.
Molecular Properties
| Compound Name | 2-methoxy-1,2,4,5-tetraphenylpyrrol-3-one |
| PubChem CID | 13129379 |
| Molecular Formula | C29H23NO2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2-methoxy-1,2,4,5-tetraphenylpyrrol-3-one |
| SMILES | COC1(c2ccccc2)C(=O)C(c2ccccc2)=C(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C29H23NO2/c1-32-29(24-18-10-4-11-19-24)28(31)26(22-14-6-2-7-15-22)27(23-16-8-3-9-17-23)30(29)25-20-12-5-13-21-25/h2-21H,1H3 |
| InChIKey | CRBOECTZXOTCHI-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-1,2,4,5-tetraphenylpyrrol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1,2,4,5-tetraphenylpyrrol-3-one?
The IUPAC name of 2-methoxy-1,2,4,5-tetraphenylpyrrol-3-one (CID 13129379) is 2-methoxy-1,2,4,5-tetraphenylpyrrol-3-one.
What is the SMILES notation for 2-methoxy-1,2,4,5-tetraphenylpyrrol-3-one?
The canonical SMILES for 2-methoxy-1,2,4,5-tetraphenylpyrrol-3-one is COC1(c2ccccc2)C(=O)C(c2ccccc2)=C(c2ccccc2)N1c1ccccc1.
What is the InChIKey of 2-methoxy-1,2,4,5-tetraphenylpyrrol-3-one?
The InChIKey is CRBOECTZXOTCHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H23NO2/c1-32-29(24-18-10-4-11-19-24)28(31)26(22-14-6-2-7-15-22)27(23-16-8-3-9-17-23)30(29)25-20-12-5-13-21-25/h2-21H,1H3.
What are the key properties of 2-methoxy-1,2,4,5-tetraphenylpyrrol-3-one?
2-methoxy-1,2,4,5-tetraphenylpyrrol-3-one has a molecular weight of 417.51 g/mol, XLogP of 6.14, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1,2,4,5-tetraphenylpyrrol-3-one is sourced from PubChem (CID 13129379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).