About 2-(3-morpholin-4-ylpropyl)-1,1-diphenylbutane-1,4-diol
2-(3-morpholin-4-ylpropyl)-1,1-diphenylbutane-1,4-diol (PubChem CID 13129495) has the molecular formula C23H31NO3
and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-(3-morpholin-4-ylpropyl)-1,1-diphenylbutane-1,4-diol.
Molecular Properties
| Compound Name | 2-(3-morpholin-4-ylpropyl)-1,1-diphenylbutane-1,4-diol |
| PubChem CID | 13129495 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 2-(3-morpholin-4-ylpropyl)-1,1-diphenylbutane-1,4-diol |
| SMILES | OCCC(CCCN1CCOCC1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NO3/c25-17-13-22(12-7-14-24-15-18-27-19-16-24)23(26,20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-6,8-11,22,25-26H,7,12-19H2 |
| InChIKey | PVVFBQXMFFFNNF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-morpholin-4-ylpropyl)-1,1-diphenylbutane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-morpholin-4-ylpropyl)-1,1-diphenylbutane-1,4-diol?
The IUPAC name of 2-(3-morpholin-4-ylpropyl)-1,1-diphenylbutane-1,4-diol (CID 13129495) is 2-(3-morpholin-4-ylpropyl)-1,1-diphenylbutane-1,4-diol.
What is the SMILES notation for 2-(3-morpholin-4-ylpropyl)-1,1-diphenylbutane-1,4-diol?
The canonical SMILES for 2-(3-morpholin-4-ylpropyl)-1,1-diphenylbutane-1,4-diol is OCCC(CCCN1CCOCC1)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(3-morpholin-4-ylpropyl)-1,1-diphenylbutane-1,4-diol?
The InChIKey is PVVFBQXMFFFNNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31NO3/c25-17-13-22(12-7-14-24-15-18-27-19-16-24)23(26,20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-6,8-11,22,25-26H,7,12-19H2.
What are the key properties of 2-(3-morpholin-4-ylpropyl)-1,1-diphenylbutane-1,4-diol?
2-(3-morpholin-4-ylpropyl)-1,1-diphenylbutane-1,4-diol has a molecular weight of 369.51 g/mol, XLogP of 3.03, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-morpholin-4-ylpropyl)-1,1-diphenylbutane-1,4-diol is sourced from PubChem (CID 13129495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).