C22H20BrClO4 — CID 1312985
(3R,6R)-3-[2-(4-bromophenyl)-2-oxoethyl]-6-(4-chlorophenyl)-3,5,5-trimethyloxane-2,4-dione (PubChem CID 1312985) has the molecular formula C22H20BrClO4 and a molecular weight of 463.76 g/mol. Its IUPAC name is (3R,6R)-3-[2-(4-bromophenyl)-2-oxoethyl]-6-(4-chlorophenyl)-3,5,5-trimethyloxane-2,4-dione.
| Compound Name | (3R,6R)-3-[2-(4-bromophenyl)-2-oxoethyl]-6-(4-chlorophenyl)-3,5,5-trimethyloxane-2,4-dione |
|---|---|
| PubChem CID | 1312985 |
| Molecular Formula | C22H20BrClO4 |
| Molecular Weight | 463.76 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | (3R,6R)-3-[2-(4-bromophenyl)-2-oxoethyl]-6-(4-chlorophenyl)-3,5,5-trimethyloxane-2,4-dione |
| SMILES | CC1(C)C(=O)[C@@](C)(CC(=O)c2ccc(Br)cc2)C(=O)O[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20BrClO4/c1-21(2)18(14-6-10-16(24)11-7-14)28-20(27)22(3,19(21)26)12-17(25)13-4-8-15(23)9-5-13/h4-11,18H,12H2,1-3H3/t18-,22-/m1/s1 |
| InChIKey | ZKWDOXDHFOHMPP-XMSQKQJNSA-N |
| XLogP | 5.57 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.76 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|