About 3,6-dimethyl-3,6-dihydro-1,2-dioxine
3,6-dimethyl-3,6-dihydro-1,2-dioxine (PubChem CID 13130002) has the molecular formula C6H10O2
and a molecular weight of 114.14 g/mol. Its IUPAC name is 3,6-dimethyl-3,6-dihydro-1,2-dioxine.
Molecular Properties
| Compound Name | 3,6-dimethyl-3,6-dihydro-1,2-dioxine |
| PubChem CID | 13130002 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 3,6-dimethyl-3,6-dihydro-1,2-dioxine |
| SMILES | CC1C=CC(C)OO1 |
| InChI | InChI=1S/C6H10O2/c1-5-3-4-6(2)8-7-5/h3-6H,1-2H3 |
| InChIKey | MDEFHXLAVXLQJA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dimethyl-3,6-dihydro-1,2-dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-3,6-dihydro-1,2-dioxine?
The IUPAC name of 3,6-dimethyl-3,6-dihydro-1,2-dioxine (CID 13130002) is 3,6-dimethyl-3,6-dihydro-1,2-dioxine.
What is the SMILES notation for 3,6-dimethyl-3,6-dihydro-1,2-dioxine?
The canonical SMILES for 3,6-dimethyl-3,6-dihydro-1,2-dioxine is CC1C=CC(C)OO1.
What is the InChIKey of 3,6-dimethyl-3,6-dihydro-1,2-dioxine?
The InChIKey is MDEFHXLAVXLQJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2/c1-5-3-4-6(2)8-7-5/h3-6H,1-2H3.
What are the key properties of 3,6-dimethyl-3,6-dihydro-1,2-dioxine?
3,6-dimethyl-3,6-dihydro-1,2-dioxine has a molecular weight of 114.14 g/mol, XLogP of 1.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-3,6-dihydro-1,2-dioxine is sourced from PubChem (CID 13130002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).