About (E)-4-(dimethylamino)-4-methyl-1,1-diphenylpent-2-en-1-ol
(E)-4-(dimethylamino)-4-methyl-1,1-diphenylpent-2-en-1-ol (PubChem CID 1313004) has the molecular formula C20H25NO
and a molecular weight of 295.43 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-4-methyl-1,1-diphenylpent-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-4-(dimethylamino)-4-methyl-1,1-diphenylpent-2-en-1-ol |
| PubChem CID | 1313004 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (E)-4-(dimethylamino)-4-methyl-1,1-diphenylpent-2-en-1-ol |
| SMILES | CN(C)C(C)(C)/C=C/C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25NO/c1-19(2,21(3)4)15-16-20(22,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-16,22H,1-4H3/b16-15+ |
| InChIKey | HBWSJIDIFKREEZ-FOCLMDBBSA-N |
| XLogP | 3.82 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(dimethylamino)-4-methyl-1,1-diphenylpent-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(dimethylamino)-4-methyl-1,1-diphenylpent-2-en-1-ol?
The IUPAC name of (E)-4-(dimethylamino)-4-methyl-1,1-diphenylpent-2-en-1-ol (CID 1313004) is (E)-4-(dimethylamino)-4-methyl-1,1-diphenylpent-2-en-1-ol.
What is the SMILES notation for (E)-4-(dimethylamino)-4-methyl-1,1-diphenylpent-2-en-1-ol?
The canonical SMILES for (E)-4-(dimethylamino)-4-methyl-1,1-diphenylpent-2-en-1-ol is CN(C)C(C)(C)/C=C/C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of (E)-4-(dimethylamino)-4-methyl-1,1-diphenylpent-2-en-1-ol?
The InChIKey is HBWSJIDIFKREEZ-FOCLMDBBSA-N. The full InChI is InChI=1S/C20H25NO/c1-19(2,21(3)4)15-16-20(22,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-16,22H,1-4H3/b16-15+.
What are the key properties of (E)-4-(dimethylamino)-4-methyl-1,1-diphenylpent-2-en-1-ol?
(E)-4-(dimethylamino)-4-methyl-1,1-diphenylpent-2-en-1-ol has a molecular weight of 295.43 g/mol, XLogP of 3.82, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(dimethylamino)-4-methyl-1,1-diphenylpent-2-en-1-ol is sourced from PubChem (CID 1313004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).