C7H10N2O — CID 131300890
4-ethyl-1-hydroxypyridin-2-imine (PubChem CID 131300890) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is 4-ethyl-1-hydroxypyridin-2-imine.
| Compound Name | 4-ethyl-1-hydroxypyridin-2-imine |
|---|---|
| PubChem CID | 131300890 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 4-ethyl-1-hydroxypyridin-2-imine |
| SMILES | [H]/N=c1\cc(CC)ccn1O |
| InChI | InChI=1S/C7H10N2O/c1-2-6-3-4-9(10)7(8)5-6/h3-5,8,10H,2H2,1H3/b8-7+ |
| InChIKey | NCTOBVQBURZLDN-BQYQJAHWSA-N |
| XLogP | 0.77 |
| TPSA | 49.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|