About (4R)-1-benzyl-4-(1,2-dihydroxyethyl)azetidin-2-one
(4R)-1-benzyl-4-(1,2-dihydroxyethyl)azetidin-2-one (PubChem CID 13130101) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is (4R)-1-benzyl-4-(1,2-dihydroxyethyl)azetidin-2-one.
Molecular Properties
| Compound Name | (4R)-1-benzyl-4-(1,2-dihydroxyethyl)azetidin-2-one |
| PubChem CID | 13130101 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (4R)-1-benzyl-4-(1,2-dihydroxyethyl)azetidin-2-one |
| SMILES | O=C1C[C@H](C(O)CO)N1Cc1ccccc1 |
| InChI | InChI=1S/C12H15NO3/c14-8-11(15)10-6-12(16)13(10)7-9-4-2-1-3-5-9/h1-5,10-11,14-15H,6-8H2/t10-,11?/m1/s1 |
| InChIKey | LSAPGFINFSNIIN-NFJWQWPMSA-N |
| XLogP | 0.14 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-1-benzyl-4-(1,2-dihydroxyethyl)azetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1-benzyl-4-(1,2-dihydroxyethyl)azetidin-2-one?
The IUPAC name of (4R)-1-benzyl-4-(1,2-dihydroxyethyl)azetidin-2-one (CID 13130101) is (4R)-1-benzyl-4-(1,2-dihydroxyethyl)azetidin-2-one.
What is the SMILES notation for (4R)-1-benzyl-4-(1,2-dihydroxyethyl)azetidin-2-one?
The canonical SMILES for (4R)-1-benzyl-4-(1,2-dihydroxyethyl)azetidin-2-one is O=C1C[C@H](C(O)CO)N1Cc1ccccc1.
What is the InChIKey of (4R)-1-benzyl-4-(1,2-dihydroxyethyl)azetidin-2-one?
The InChIKey is LSAPGFINFSNIIN-NFJWQWPMSA-N. The full InChI is InChI=1S/C12H15NO3/c14-8-11(15)10-6-12(16)13(10)7-9-4-2-1-3-5-9/h1-5,10-11,14-15H,6-8H2/t10-,11?/m1/s1.
What are the key properties of (4R)-1-benzyl-4-(1,2-dihydroxyethyl)azetidin-2-one?
(4R)-1-benzyl-4-(1,2-dihydroxyethyl)azetidin-2-one has a molecular weight of 221.26 g/mol, XLogP of 0.14, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1-benzyl-4-(1,2-dihydroxyethyl)azetidin-2-one is sourced from PubChem (CID 13130101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).