About 2-phenylpentan-1-ol
2-phenylpentan-1-ol (PubChem CID 13130288) has the molecular formula C11H16O
and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-phenylpentan-1-ol.
Molecular Properties
| Compound Name | 2-phenylpentan-1-ol |
| PubChem CID | 13130288 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 2-phenylpentan-1-ol |
| SMILES | CCCC(CO)c1ccccc1 |
| InChI | InChI=1S/C11H16O/c1-2-6-11(9-12)10-7-4-3-5-8-10/h3-5,7-8,11-12H,2,6,9H2,1H3 |
| InChIKey | YYMFORUEYFGNKM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpentan-1-ol?
The IUPAC name of 2-phenylpentan-1-ol (CID 13130288) is 2-phenylpentan-1-ol.
What is the SMILES notation for 2-phenylpentan-1-ol?
The canonical SMILES for 2-phenylpentan-1-ol is CCCC(CO)c1ccccc1.
What is the InChIKey of 2-phenylpentan-1-ol?
The InChIKey is YYMFORUEYFGNKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O/c1-2-6-11(9-12)10-7-4-3-5-8-10/h3-5,7-8,11-12H,2,6,9H2,1H3.
What are the key properties of 2-phenylpentan-1-ol?
2-phenylpentan-1-ol has a molecular weight of 164.25 g/mol, XLogP of 2.56, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpentan-1-ol is sourced from PubChem (CID 13130288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).