About 7-ethoxy-4,4-dimethylbicyclo[4.2.0]oct-1(6)-en-2-one
7-ethoxy-4,4-dimethylbicyclo[4.2.0]oct-1(6)-en-2-one (PubChem CID 13130304) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 7-ethoxy-4,4-dimethylbicyclo[4.2.0]oct-1(6)-en-2-one.
Molecular Properties
| Compound Name | 7-ethoxy-4,4-dimethylbicyclo[4.2.0]oct-1(6)-en-2-one |
| PubChem CID | 13130304 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 7-ethoxy-4,4-dimethylbicyclo[4.2.0]oct-1(6)-en-2-one |
| SMILES | CCOC1CC2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C12H18O2/c1-4-14-11-5-8-9(11)6-12(2,3)7-10(8)13/h11H,4-7H2,1-3H3 |
| InChIKey | JDRBVVINSJENNA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-ethoxy-4,4-dimethylbicyclo[4.2.0]oct-1(6)-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxy-4,4-dimethylbicyclo[4.2.0]oct-1(6)-en-2-one?
The IUPAC name of 7-ethoxy-4,4-dimethylbicyclo[4.2.0]oct-1(6)-en-2-one (CID 13130304) is 7-ethoxy-4,4-dimethylbicyclo[4.2.0]oct-1(6)-en-2-one.
What is the SMILES notation for 7-ethoxy-4,4-dimethylbicyclo[4.2.0]oct-1(6)-en-2-one?
The canonical SMILES for 7-ethoxy-4,4-dimethylbicyclo[4.2.0]oct-1(6)-en-2-one is CCOC1CC2=C1CC(C)(C)CC2=O.
What is the InChIKey of 7-ethoxy-4,4-dimethylbicyclo[4.2.0]oct-1(6)-en-2-one?
The InChIKey is JDRBVVINSJENNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-4-14-11-5-8-9(11)6-12(2,3)7-10(8)13/h11H,4-7H2,1-3H3.
What are the key properties of 7-ethoxy-4,4-dimethylbicyclo[4.2.0]oct-1(6)-en-2-one?
7-ethoxy-4,4-dimethylbicyclo[4.2.0]oct-1(6)-en-2-one has a molecular weight of 194.27 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-4,4-dimethylbicyclo[4.2.0]oct-1(6)-en-2-one is sourced from PubChem (CID 13130304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).