C20H16O3 — CID 13130307
3,3-dimethyl-2,4-dihydrotetracene-1,6,11-trione (PubChem CID 13130307) has the molecular formula C20H16O3 and a molecular weight of 304.34 g/mol. Its IUPAC name is 3,3-dimethyl-2,4-dihydrotetracene-1,6,11-trione.
| Compound Name | 3,3-dimethyl-2,4-dihydrotetracene-1,6,11-trione |
|---|---|
| PubChem CID | 13130307 |
| Molecular Formula | C20H16O3 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3,3-dimethyl-2,4-dihydrotetracene-1,6,11-trione |
| SMILES | CC1(C)CC(=O)c2cc3c(cc2C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C20H16O3/c1-20(2)9-11-7-15-16(8-14(11)17(21)10-20)19(23)13-6-4-3-5-12(13)18(15)22/h3-8H,9-10H2,1-2H3 |
| InChIKey | YOLTVLQCAHILAQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|