C14H22O4 — CID 13130561
diethyl (1R,2R)-4,5-dimethylcyclohex-4-ene-1,2-dicarboxylate (PubChem CID 13130561) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is diethyl (1R,2R)-4,5-dimethylcyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | diethyl (1R,2R)-4,5-dimethylcyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 13130561 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | diethyl (1R,2R)-4,5-dimethylcyclohex-4-ene-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CC(C)=C(C)C[C@H]1C(=O)OCC |
| InChI | InChI=1S/C14H22O4/c1-5-17-13(15)11-7-9(3)10(4)8-12(11)14(16)18-6-2/h11-12H,5-8H2,1-4H3/t11-,12-/m1/s1 |
| InChIKey | FOWFLRQXOYNTGP-VXGBXAGGSA-N |
| XLogP | 2.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|