About 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrobromide
1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrobromide (PubChem CID 13130947) has the molecular formula C5H7BrN2OS
and a molecular weight of 223.09 g/mol. Its IUPAC name is 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrobromide.
Molecular Properties
| Compound Name | 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrobromide |
| PubChem CID | 13130947 |
| Molecular Formula | C5H7BrN2OS |
| Molecular Weight | 223.09 g/mol |
| Exact Mass | 221.95 |
| IUPAC Name | 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrobromide |
| SMILES | Br.CC(=O)c1cnc(N)s1 |
| InChI | InChI=1S/C5H6N2OS.BrH/c1-3(8)4-2-7-5(6)9-4;/h2H,1H3,(H2,6,7);1H |
| InChIKey | MGSOMWDJYPNKFY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.09 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrobromide?
The IUPAC name of 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrobromide (CID 13130947) is 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrobromide.
What is the SMILES notation for 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrobromide?
The canonical SMILES for 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrobromide is Br.CC(=O)c1cnc(N)s1.
What is the InChIKey of 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrobromide?
The InChIKey is MGSOMWDJYPNKFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2OS.BrH/c1-3(8)4-2-7-5(6)9-4;/h2H,1H3,(H2,6,7);1H.
What are the key properties of 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrobromide?
1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrobromide has a molecular weight of 223.09 g/mol, XLogP of 1.51, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-1,3-thiazol-5-yl)ethanone;hydrobromide is sourced from PubChem (CID 13130947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).