C9H8N4OS — CID 13131314
(5-phenyl-1,2,4-thiadiazol-3-yl)urea (PubChem CID 13131314) has the molecular formula C9H8N4OS and a molecular weight of 220.26 g/mol. Its IUPAC name is (5-phenyl-1,2,4-thiadiazol-3-yl)urea.
| Compound Name | (5-phenyl-1,2,4-thiadiazol-3-yl)urea |
|---|---|
| PubChem CID | 13131314 |
| Molecular Formula | C9H8N4OS |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | (5-phenyl-1,2,4-thiadiazol-3-yl)urea |
| SMILES | NC(=O)Nc1nsc(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H8N4OS/c10-8(14)12-9-11-7(15-13-9)6-4-2-1-3-5-6/h1-5H,(H3,10,12,13,14) |
| InChIKey | DADWYVMVHRZGOE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |