C11H16O2 — CID 131316252
(2-ethoxy-4,5-dimethylphenyl)methanol (PubChem CID 131316252) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (2-ethoxy-4,5-dimethylphenyl)methanol.
| Compound Name | (2-ethoxy-4,5-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 131316252 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (2-ethoxy-4,5-dimethylphenyl)methanol |
| SMILES | CCOc1cc(C)c(C)cc1CO |
| InChI | InChI=1S/C11H16O2/c1-4-13-11-6-9(3)8(2)5-10(11)7-12/h5-6,12H,4,7H2,1-3H3 |
| InChIKey | HAOWZHNHCHPARZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |