About 2-bromo-3,4-dimethylbenzonitrile
2-bromo-3,4-dimethylbenzonitrile (PubChem CID 131324327) has the molecular formula C9H8BrN
and a molecular weight of 210.07 g/mol. Its IUPAC name is 2-bromo-3,4-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 2-bromo-3,4-dimethylbenzonitrile |
| PubChem CID | 131324327 |
| Molecular Formula | C9H8BrN |
| Molecular Weight | 210.07 g/mol |
| Exact Mass | 208.98 |
| IUPAC Name | 2-bromo-3,4-dimethylbenzonitrile |
| SMILES | Cc1ccc(C#N)c(Br)c1C |
| InChI | InChI=1S/C9H8BrN/c1-6-3-4-8(5-11)9(10)7(6)2/h3-4H,1-2H3 |
| InChIKey | KOMHDSYTLDGMCU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.07 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-3,4-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3,4-dimethylbenzonitrile?
The IUPAC name of 2-bromo-3,4-dimethylbenzonitrile (CID 131324327) is 2-bromo-3,4-dimethylbenzonitrile.
What is the SMILES notation for 2-bromo-3,4-dimethylbenzonitrile?
The canonical SMILES for 2-bromo-3,4-dimethylbenzonitrile is Cc1ccc(C#N)c(Br)c1C.
What is the InChIKey of 2-bromo-3,4-dimethylbenzonitrile?
The InChIKey is KOMHDSYTLDGMCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrN/c1-6-3-4-8(5-11)9(10)7(6)2/h3-4H,1-2H3.
What are the key properties of 2-bromo-3,4-dimethylbenzonitrile?
2-bromo-3,4-dimethylbenzonitrile has a molecular weight of 210.07 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3,4-dimethylbenzonitrile is sourced from PubChem (CID 131324327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).