C11H9NO3 — CID 131333880
3-(5-methyl-1,3-benzoxazol-2-yl)prop-2-enoic acid (PubChem CID 131333880) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 3-(5-methyl-1,3-benzoxazol-2-yl)prop-2-enoic acid.
| Compound Name | 3-(5-methyl-1,3-benzoxazol-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 131333880 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 3-(5-methyl-1,3-benzoxazol-2-yl)prop-2-enoic acid |
| SMILES | Cc1ccc2oc(C=CC(=O)O)nc2c1 |
| InChI | InChI=1S/C11H9NO3/c1-7-2-3-9-8(6-7)12-10(15-9)4-5-11(13)14/h2-6H,1H3,(H,13,14) |
| InChIKey | YPTWNEHBNOWEQL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|