C9H6Br2O3S — CID 131335873
3,6-dibromo-1,1-dioxo-2,3-dihydrothiochromen-4-one (PubChem CID 131335873) has the molecular formula C9H6Br2O3S and a molecular weight of 354.02 g/mol. Its IUPAC name is 3,6-dibromo-1,1-dioxo-2,3-dihydrothiochromen-4-one.
| Compound Name | 3,6-dibromo-1,1-dioxo-2,3-dihydrothiochromen-4-one |
|---|---|
| PubChem CID | 131335873 |
| Molecular Formula | C9H6Br2O3S |
| Molecular Weight | 354.02 g/mol |
| Exact Mass | 351.84 |
| IUPAC Name | 3,6-dibromo-1,1-dioxo-2,3-dihydrothiochromen-4-one |
| SMILES | O=C1c2cc(Br)ccc2S(=O)(=O)CC1Br |
| InChI | InChI=1S/C9H6Br2O3S/c10-5-1-2-8-6(3-5)9(12)7(11)4-15(8,13)14/h1-3,7H,4H2 |
| InChIKey | VCTORWBORJAJTP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.02 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|