C14H24O — CID 13133867
(3aR,6S,8aR)-6-tert-butyl-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-4-one (PubChem CID 13133867) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (3aR,6S,8aR)-6-tert-butyl-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-4-one.
| Compound Name | (3aR,6S,8aR)-6-tert-butyl-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-4-one |
|---|---|
| PubChem CID | 13133867 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (3aR,6S,8aR)-6-tert-butyl-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-4-one |
| SMILES | CC(C)(C)[C@H]1CC[C@H]2CCC[C@H]2C(=O)C1 |
| InChI | InChI=1S/C14H24O/c1-14(2,3)11-8-7-10-5-4-6-12(10)13(15)9-11/h10-12H,4-9H2,1-3H3/t10-,11+,12-/m1/s1 |
| InChIKey | BRQWBXRHUTUIOE-GRYCIOLGSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |