About 6-methyl-3,4-dihydro-1H-pyrimidine-2-thione
6-methyl-3,4-dihydro-1H-pyrimidine-2-thione (PubChem CID 13134055) has the molecular formula C5H8N2S
and a molecular weight of 128.20 g/mol. Its IUPAC name is 6-methyl-3,4-dihydro-1H-pyrimidine-2-thione.
Molecular Properties
| Compound Name | 6-methyl-3,4-dihydro-1H-pyrimidine-2-thione |
| PubChem CID | 13134055 |
| Molecular Formula | C5H8N2S |
| Molecular Weight | 128.20 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | 6-methyl-3,4-dihydro-1H-pyrimidine-2-thione |
| SMILES | CC1=CCNC(=S)N1 |
| InChI | InChI=1S/C5H8N2S/c1-4-2-3-6-5(8)7-4/h2H,3H2,1H3,(H2,6,7,8) |
| InChIKey | QFMYNYBQGDAHDF-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-3,4-dihydro-1H-pyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3,4-dihydro-1H-pyrimidine-2-thione?
The IUPAC name of 6-methyl-3,4-dihydro-1H-pyrimidine-2-thione (CID 13134055) is 6-methyl-3,4-dihydro-1H-pyrimidine-2-thione.
What is the SMILES notation for 6-methyl-3,4-dihydro-1H-pyrimidine-2-thione?
The canonical SMILES for 6-methyl-3,4-dihydro-1H-pyrimidine-2-thione is CC1=CCNC(=S)N1.
What is the InChIKey of 6-methyl-3,4-dihydro-1H-pyrimidine-2-thione?
The InChIKey is QFMYNYBQGDAHDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2S/c1-4-2-3-6-5(8)7-4/h2H,3H2,1H3,(H2,6,7,8).
What are the key properties of 6-methyl-3,4-dihydro-1H-pyrimidine-2-thione?
6-methyl-3,4-dihydro-1H-pyrimidine-2-thione has a molecular weight of 128.20 g/mol, XLogP of 0.37, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3,4-dihydro-1H-pyrimidine-2-thione is sourced from PubChem (CID 13134055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).