C19H21ClN2O3 — CID 1313437
N-[2-[[(2R)-2-(3-chlorophenoxy)propanoyl]amino]phenyl]butanamide (PubChem CID 1313437) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is N-[2-[[(2R)-2-(3-chlorophenoxy)propanoyl]amino]phenyl]butanamide.
| Compound Name | N-[2-[[(2R)-2-(3-chlorophenoxy)propanoyl]amino]phenyl]butanamide |
|---|---|
| PubChem CID | 1313437 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-[2-[[(2R)-2-(3-chlorophenoxy)propanoyl]amino]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccccc1NC(=O)[C@@H](C)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H21ClN2O3/c1-3-7-18(23)21-16-10-4-5-11-17(16)22-19(24)13(2)25-15-9-6-8-14(20)12-15/h4-6,8-13H,3,7H2,1-2H3,(H,21,23)(H,22,24)/t13-/m1/s1 |
| InChIKey | COGXEKFTKRSVDT-CYBMUJFWSA-N |
| XLogP | 4.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |