About 8-bromo-5-fluoro-3,4-dihydro-1H-naphthalen-2-one
8-bromo-5-fluoro-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 131343889) has the molecular formula C10H8BrFO
and a molecular weight of 243.07 g/mol. Its IUPAC name is 8-bromo-5-fluoro-3,4-dihydro-1H-naphthalen-2-one.
Molecular Properties
| Compound Name | 8-bromo-5-fluoro-3,4-dihydro-1H-naphthalen-2-one |
| PubChem CID | 131343889 |
| Molecular Formula | C10H8BrFO |
| Molecular Weight | 243.07 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | 8-bromo-5-fluoro-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | O=C1CCc2c(F)ccc(Br)c2C1 |
| InChI | InChI=1S/C10H8BrFO/c11-9-3-4-10(12)7-2-1-6(13)5-8(7)9/h3-4H,1-2,5H2 |
| InChIKey | BAYPQZBRSACYBQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.07 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-bromo-5-fluoro-3,4-dihydro-1H-naphthalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-5-fluoro-3,4-dihydro-1H-naphthalen-2-one?
The IUPAC name of 8-bromo-5-fluoro-3,4-dihydro-1H-naphthalen-2-one (CID 131343889) is 8-bromo-5-fluoro-3,4-dihydro-1H-naphthalen-2-one.
What is the SMILES notation for 8-bromo-5-fluoro-3,4-dihydro-1H-naphthalen-2-one?
The canonical SMILES for 8-bromo-5-fluoro-3,4-dihydro-1H-naphthalen-2-one is O=C1CCc2c(F)ccc(Br)c2C1.
What is the InChIKey of 8-bromo-5-fluoro-3,4-dihydro-1H-naphthalen-2-one?
The InChIKey is BAYPQZBRSACYBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrFO/c11-9-3-4-10(12)7-2-1-6(13)5-8(7)9/h3-4H,1-2,5H2.
What are the key properties of 8-bromo-5-fluoro-3,4-dihydro-1H-naphthalen-2-one?
8-bromo-5-fluoro-3,4-dihydro-1H-naphthalen-2-one has a molecular weight of 243.07 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-5-fluoro-3,4-dihydro-1H-naphthalen-2-one is sourced from PubChem (CID 131343889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).