About (2E,5E)-3-chlorohepta-2,5-dien-4-one
(2E,5E)-3-chlorohepta-2,5-dien-4-one (PubChem CID 131345605) has the molecular formula C7H9ClO
and a molecular weight of 144.60 g/mol. Its IUPAC name is (2E,5E)-3-chlorohepta-2,5-dien-4-one.
Molecular Properties
| Compound Name | (2E,5E)-3-chlorohepta-2,5-dien-4-one |
| PubChem CID | 131345605 |
| Molecular Formula | C7H9ClO |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.03 |
| IUPAC Name | (2E,5E)-3-chlorohepta-2,5-dien-4-one |
| SMILES | C/C=C/C(=O)/C(Cl)=C\C |
| InChI | InChI=1S/C7H9ClO/c1-3-5-7(9)6(8)4-2/h3-5H,1-2H3/b5-3+,6-4+ |
| InChIKey | DFOAXBVEVMRGOV-GGWOSOGESA-N |
| XLogP | 2.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E,5E)-3-chlorohepta-2,5-dien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,5E)-3-chlorohepta-2,5-dien-4-one?
The IUPAC name of (2E,5E)-3-chlorohepta-2,5-dien-4-one (CID 131345605) is (2E,5E)-3-chlorohepta-2,5-dien-4-one.
What is the SMILES notation for (2E,5E)-3-chlorohepta-2,5-dien-4-one?
The canonical SMILES for (2E,5E)-3-chlorohepta-2,5-dien-4-one is C/C=C/C(=O)/C(Cl)=C\C.
What is the InChIKey of (2E,5E)-3-chlorohepta-2,5-dien-4-one?
The InChIKey is DFOAXBVEVMRGOV-GGWOSOGESA-N. The full InChI is InChI=1S/C7H9ClO/c1-3-5-7(9)6(8)4-2/h3-5H,1-2H3/b5-3+,6-4+.
What are the key properties of (2E,5E)-3-chlorohepta-2,5-dien-4-one?
(2E,5E)-3-chlorohepta-2,5-dien-4-one has a molecular weight of 144.60 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,5E)-3-chlorohepta-2,5-dien-4-one is sourced from PubChem (CID 131345605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).