About 2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine
2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine (PubChem CID 13135009) has the molecular formula C3H9N2O2P
and a molecular weight of 136.09 g/mol. Its IUPAC name is 2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine.
Molecular Properties
| Compound Name | 2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine |
| PubChem CID | 13135009 |
| Molecular Formula | C3H9N2O2P |
| Molecular Weight | 136.09 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine |
| SMILES | NP1(=O)NCCCO1 |
| InChI | InChI=1S/C3H9N2O2P/c4-8(6)5-2-1-3-7-8/h1-3H2,(H3,4,5,6) |
| InChIKey | MIXHOBKUJPATMK-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.09 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine?
The IUPAC name of 2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine (CID 13135009) is 2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine.
What is the SMILES notation for 2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine?
The canonical SMILES for 2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine is NP1(=O)NCCCO1.
What is the InChIKey of 2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine?
The InChIKey is MIXHOBKUJPATMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N2O2P/c4-8(6)5-2-1-3-7-8/h1-3H2,(H3,4,5,6).
What are the key properties of 2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine?
2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine has a molecular weight of 136.09 g/mol, XLogP of 0.06, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine is sourced from PubChem (CID 13135009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).