About ethyl 6-[3-(diethylamino)prop-1-ynyl]-9H-pyrido[3,4-b]indole-3-carboxylate
ethyl 6-[3-(diethylamino)prop-1-ynyl]-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 13136242) has the molecular formula C21H23N3O2
and a molecular weight of 349.43 g/mol. Its IUPAC name is ethyl 6-[3-(diethylamino)prop-1-ynyl]-9H-pyrido[3,4-b]indole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-[3-(diethylamino)prop-1-ynyl]-9H-pyrido[3,4-b]indole-3-carboxylate |
| PubChem CID | 13136242 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | ethyl 6-[3-(diethylamino)prop-1-ynyl]-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c(cn1)[nH]c1ccc(C#CCN(CC)CC)cc12 |
| InChI | InChI=1S/C21H23N3O2/c1-4-24(5-2)11-7-8-15-9-10-18-16(12-15)17-13-19(21(25)26-6-3)22-14-20(17)23-18/h9-10,12-14,23H,4-6,11H2,1-3H3 |
| InChIKey | AYLDQMNYPRKMBN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-[3-(diethylamino)prop-1-ynyl]-9H-pyrido[3,4-b]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-[3-(diethylamino)prop-1-ynyl]-9H-pyrido[3,4-b]indole-3-carboxylate?
The IUPAC name of ethyl 6-[3-(diethylamino)prop-1-ynyl]-9H-pyrido[3,4-b]indole-3-carboxylate (CID 13136242) is ethyl 6-[3-(diethylamino)prop-1-ynyl]-9H-pyrido[3,4-b]indole-3-carboxylate.
What is the SMILES notation for ethyl 6-[3-(diethylamino)prop-1-ynyl]-9H-pyrido[3,4-b]indole-3-carboxylate?
The canonical SMILES for ethyl 6-[3-(diethylamino)prop-1-ynyl]-9H-pyrido[3,4-b]indole-3-carboxylate is CCOC(=O)c1cc2c(cn1)[nH]c1ccc(C#CCN(CC)CC)cc12.
What is the InChIKey of ethyl 6-[3-(diethylamino)prop-1-ynyl]-9H-pyrido[3,4-b]indole-3-carboxylate?
The InChIKey is AYLDQMNYPRKMBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O2/c1-4-24(5-2)11-7-8-15-9-10-18-16(12-15)17-13-19(21(25)26-6-3)22-14-20(17)23-18/h9-10,12-14,23H,4-6,11H2,1-3H3.
What are the key properties of ethyl 6-[3-(diethylamino)prop-1-ynyl]-9H-pyrido[3,4-b]indole-3-carboxylate?
ethyl 6-[3-(diethylamino)prop-1-ynyl]-9H-pyrido[3,4-b]indole-3-carboxylate has a molecular weight of 349.43 g/mol, XLogP of 3.59, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[3-(diethylamino)prop-1-ynyl]-9H-pyrido[3,4-b]indole-3-carboxylate is sourced from PubChem (CID 13136242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).