About (5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-yl)methanamine
(5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-yl)methanamine (PubChem CID 13136452) has the molecular formula C16H17N3
and a molecular weight of 251.33 g/mol. Its IUPAC name is (5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-yl)methanamine.
Molecular Properties
| Compound Name | (5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-yl)methanamine |
| PubChem CID | 13136452 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-yl)methanamine |
| SMILES | NCC1CN=C(c2ccccc2)c2ccccc2N1 |
| InChI | InChI=1S/C16H17N3/c17-10-13-11-18-16(12-6-2-1-3-7-12)14-8-4-5-9-15(14)19-13/h1-9,13,19H,10-11,17H2 |
| InChIKey | HAYNMBQGUNAMTP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-yl)methanamine?
The IUPAC name of (5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-yl)methanamine (CID 13136452) is (5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-yl)methanamine.
What is the SMILES notation for (5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-yl)methanamine?
The canonical SMILES for (5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-yl)methanamine is NCC1CN=C(c2ccccc2)c2ccccc2N1.
What is the InChIKey of (5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-yl)methanamine?
The InChIKey is HAYNMBQGUNAMTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3/c17-10-13-11-18-16(12-6-2-1-3-7-12)14-8-4-5-9-15(14)19-13/h1-9,13,19H,10-11,17H2.
What are the key properties of (5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-yl)methanamine?
(5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-yl)methanamine has a molecular weight of 251.33 g/mol, XLogP of 2.28, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-yl)methanamine is sourced from PubChem (CID 13136452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).