About methyl 2,2-difluoro-2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate
methyl 2,2-difluoro-2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate (PubChem CID 131364625) has the molecular formula C7H10F2O5S
and a molecular weight of 244.21 g/mol. Its IUPAC name is methyl 2,2-difluoro-2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate.
Molecular Properties
| Compound Name | methyl 2,2-difluoro-2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate |
| PubChem CID | 131364625 |
| Molecular Formula | C7H10F2O5S |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | methyl 2,2-difluoro-2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate |
| SMILES | COC(=O)C(F)(F)C1(O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H10F2O5S/c1-14-5(10)7(8,9)6(11)2-3-15(12,13)4-6/h11H,2-4H2,1H3 |
| InChIKey | UOLJTRBBIGFZPX-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2,2-difluoro-2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,2-difluoro-2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate?
The IUPAC name of methyl 2,2-difluoro-2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate (CID 131364625) is methyl 2,2-difluoro-2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate.
What is the SMILES notation for methyl 2,2-difluoro-2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate?
The canonical SMILES for methyl 2,2-difluoro-2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate is COC(=O)C(F)(F)C1(O)CCS(=O)(=O)C1.
What is the InChIKey of methyl 2,2-difluoro-2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate?
The InChIKey is UOLJTRBBIGFZPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2O5S/c1-14-5(10)7(8,9)6(11)2-3-15(12,13)4-6/h11H,2-4H2,1H3.
What are the key properties of methyl 2,2-difluoro-2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate?
methyl 2,2-difluoro-2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate has a molecular weight of 244.21 g/mol, XLogP of -0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-difluoro-2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate is sourced from PubChem (CID 131364625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).