About 2,2-diethoxyethanimidamide;hydrochloride
2,2-diethoxyethanimidamide;hydrochloride (PubChem CID 13136495) has the molecular formula C6H15ClN2O2
and a molecular weight of 182.65 g/mol. Its IUPAC name is 2,2-diethoxyethanimidamide;hydrochloride.
Molecular Properties
| Compound Name | 2,2-diethoxyethanimidamide;hydrochloride |
| PubChem CID | 13136495 |
| Molecular Formula | C6H15ClN2O2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 2,2-diethoxyethanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)C(OCC)OCC |
| InChI | InChI=1S/C6H14N2O2.ClH/c1-3-9-6(5(7)8)10-4-2;/h6H,3-4H2,1-2H3,(H3,7,8);1H |
| InChIKey | BKCPVXSSIONVRZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethoxyethanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethoxyethanimidamide;hydrochloride?
The IUPAC name of 2,2-diethoxyethanimidamide;hydrochloride (CID 13136495) is 2,2-diethoxyethanimidamide;hydrochloride.
What is the SMILES notation for 2,2-diethoxyethanimidamide;hydrochloride?
The canonical SMILES for 2,2-diethoxyethanimidamide;hydrochloride is Cl.[H]/N=C(\N)C(OCC)OCC.
What is the InChIKey of 2,2-diethoxyethanimidamide;hydrochloride?
The InChIKey is BKCPVXSSIONVRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O2.ClH/c1-3-9-6(5(7)8)10-4-2;/h6H,3-4H2,1-2H3,(H3,7,8);1H.
What are the key properties of 2,2-diethoxyethanimidamide;hydrochloride?
2,2-diethoxyethanimidamide;hydrochloride has a molecular weight of 182.65 g/mol, XLogP of 0.74, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethoxyethanimidamide;hydrochloride is sourced from PubChem (CID 13136495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).