About 3-[(E)-[1-(4-fluorophenyl)-4-phenylbutylidene]amino]oxy-N,N-dimethylpropan-1-amine
3-[(E)-[1-(4-fluorophenyl)-4-phenylbutylidene]amino]oxy-N,N-dimethylpropan-1-amine (PubChem CID 13136658) has the molecular formula C21H27FN2O
and a molecular weight of 342.46 g/mol. Its IUPAC name is 3-[(E)-[1-(4-fluorophenyl)-4-phenylbutylidene]amino]oxy-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[(E)-[1-(4-fluorophenyl)-4-phenylbutylidene]amino]oxy-N,N-dimethylpropan-1-amine |
| PubChem CID | 13136658 |
| Molecular Formula | C21H27FN2O |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 3-[(E)-[1-(4-fluorophenyl)-4-phenylbutylidene]amino]oxy-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCO/N=C(\CCCc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H27FN2O/c1-24(2)16-7-17-25-23-21(19-12-14-20(22)15-13-19)11-6-10-18-8-4-3-5-9-18/h3-5,8-9,12-15H,6-7,10-11,16-17H2,1-2H3/b23-21+ |
| InChIKey | FNHILUGIXADGSW-XTQSDGFTSA-N |
| XLogP | 4.52 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-[1-(4-fluorophenyl)-4-phenylbutylidene]amino]oxy-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-[1-(4-fluorophenyl)-4-phenylbutylidene]amino]oxy-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-[(E)-[1-(4-fluorophenyl)-4-phenylbutylidene]amino]oxy-N,N-dimethylpropan-1-amine (CID 13136658) is 3-[(E)-[1-(4-fluorophenyl)-4-phenylbutylidene]amino]oxy-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-[(E)-[1-(4-fluorophenyl)-4-phenylbutylidene]amino]oxy-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-[(E)-[1-(4-fluorophenyl)-4-phenylbutylidene]amino]oxy-N,N-dimethylpropan-1-amine is CN(C)CCCO/N=C(\CCCc1ccccc1)c1ccc(F)cc1.
What is the InChIKey of 3-[(E)-[1-(4-fluorophenyl)-4-phenylbutylidene]amino]oxy-N,N-dimethylpropan-1-amine?
The InChIKey is FNHILUGIXADGSW-XTQSDGFTSA-N. The full InChI is InChI=1S/C21H27FN2O/c1-24(2)16-7-17-25-23-21(19-12-14-20(22)15-13-19)11-6-10-18-8-4-3-5-9-18/h3-5,8-9,12-15H,6-7,10-11,16-17H2,1-2H3/b23-21+.
What are the key properties of 3-[(E)-[1-(4-fluorophenyl)-4-phenylbutylidene]amino]oxy-N,N-dimethylpropan-1-amine?
3-[(E)-[1-(4-fluorophenyl)-4-phenylbutylidene]amino]oxy-N,N-dimethylpropan-1-amine has a molecular weight of 342.46 g/mol, XLogP of 4.52, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-[1-(4-fluorophenyl)-4-phenylbutylidene]amino]oxy-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 13136658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).